C15H22FN — CID 143603539
(2E,5E,8E,10E)-11-fluoro-3,4,6-trimethyldodeca-2,5,8,10-tetraen-1-imine (PubChem CID 143603539) has the molecular formula C15H22FN and a molecular weight of 235.35 g/mol. Its IUPAC name is (2E,5E,8E,10E)-11-fluoro-3,4,6-trimethyldodeca-2,5,8,10-tetraen-1-imine.
| Compound Name | (2E,5E,8E,10E)-11-fluoro-3,4,6-trimethyldodeca-2,5,8,10-tetraen-1-imine |
|---|---|
| PubChem CID | 143603539 |
| Molecular Formula | C15H22FN |
| Molecular Weight | 235.35 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | (2E,5E,8E,10E)-11-fluoro-3,4,6-trimethyldodeca-2,5,8,10-tetraen-1-imine |
| SMILES | [H]/N=C/C=C(\C)C(C)/C=C(\C)C/C=C/C=C(\C)F |
| InChI | InChI=1S/C15H22FN/c1-12(7-5-6-8-15(4)16)11-14(3)13(2)9-10-17/h5-6,8-11,14,17H,7H2,1-4H3/b6-5+,12-11+,13-9+,15-8+,17-10+ |
| InChIKey | GQLWYULQJXJQSJ-FTHJRQIASA-N |
| XLogP | 4.98 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.35 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|