C12H13F2N — CID 123811165
3-[4-(1,1-difluoroethyl)cyclohepta-1,4,6-trien-1-yl]prop-2-en-1-imine (PubChem CID 123811165) has the molecular formula C12H13F2N and a molecular weight of 209.24 g/mol. Its IUPAC name is 3-[4-(1,1-difluoroethyl)cyclohepta-1,4,6-trien-1-yl]prop-2-en-1-imine.
| Compound Name | 3-[4-(1,1-difluoroethyl)cyclohepta-1,4,6-trien-1-yl]prop-2-en-1-imine |
|---|---|
| PubChem CID | 123811165 |
| Molecular Formula | C12H13F2N |
| Molecular Weight | 209.24 g/mol |
| Exact Mass | 209.10 |
| IUPAC Name | 3-[4-(1,1-difluoroethyl)cyclohepta-1,4,6-trien-1-yl]prop-2-en-1-imine |
| SMILES | [H]/N=C/C=CC1=CCC(C(C)(F)F)=CC=C1 |
| InChI | InChI=1S/C12H13F2N/c1-12(13,14)11-6-2-4-10(7-8-11)5-3-9-15/h2-7,9,15H,8H2,1H3/b5-3?,15-9+ |
| InChIKey | DMLOFZSQXPJGOW-GSKJTONGSA-N |
| XLogP | 3.66 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.24 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|