C8H10FN — CID 163700177
(4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)methanimine (PubChem CID 163700177) has the molecular formula C8H10FN and a molecular weight of 139.17 g/mol. Its IUPAC name is (4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)methanimine.
| Compound Name | (4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)methanimine |
|---|---|
| PubChem CID | 163700177 |
| Molecular Formula | C8H10FN |
| Molecular Weight | 139.17 g/mol |
| Exact Mass | 139.08 |
| IUPAC Name | (4-fluoro-5-methylcyclohexa-2,4-dien-1-yl)methanimine |
| SMILES | [H]/N=C/C1C=CC(F)=C(C)C1 |
| InChI | InChI=1S/C8H10FN/c1-6-4-7(5-10)2-3-8(6)9/h2-3,5,7,10H,4H2,1H3/b10-5+ |
| InChIKey | KAIAJBUFEANHOQ-BJMVGYQFSA-N |
| XLogP | 2.46 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 139.17 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|