About (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine
(4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine (PubChem CID 163708683) has the molecular formula C8H8F2IN
and a molecular weight of 283.06 g/mol. Its IUPAC name is (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine.
Molecular Properties
| Compound Name | (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine |
| PubChem CID | 163708683 |
| Molecular Formula | C8H8F2IN |
| Molecular Weight | 283.06 g/mol |
| Exact Mass | 282.97 |
| IUPAC Name | (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine |
| SMILES | [H]/N=C/C1=CC(I)=C(F)C(C)C1F |
| InChI | InChI=1S/C8H8F2IN/c1-4-7(9)5(3-12)2-6(11)8(4)10/h2-4,7,12H,1H3/b12-3+ |
| InChIKey | KHHPGSQMKGYNBF-KGVSQERTSA-N |
| XLogP | 3.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.06 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine?
The IUPAC name of (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine (CID 163708683) is (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine.
What is the SMILES notation for (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine?
The canonical SMILES for (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine is [H]/N=C/C1=CC(I)=C(F)C(C)C1F.
What is the InChIKey of (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine?
The InChIKey is KHHPGSQMKGYNBF-KGVSQERTSA-N. The full InChI is InChI=1S/C8H8F2IN/c1-4-7(9)5(3-12)2-6(11)8(4)10/h2-4,7,12H,1H3/b12-3+.
What are the key properties of (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine?
(4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine has a molecular weight of 283.06 g/mol, XLogP of 3.17, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-difluoro-3-iodo-5-methylcyclohexa-1,3-dien-1-yl)methanimine is sourced from PubChem (CID 163708683), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).