C10H12F3N — CID 123684141
2-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propan-1-imine (PubChem CID 123684141) has the molecular formula C10H12F3N and a molecular weight of 203.21 g/mol. Its IUPAC name is 2-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propan-1-imine.
| Compound Name | 2-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propan-1-imine |
|---|---|
| PubChem CID | 123684141 |
| Molecular Formula | C10H12F3N |
| Molecular Weight | 203.21 g/mol |
| Exact Mass | 203.09 |
| IUPAC Name | 2-[5-(trifluoromethyl)cyclohexa-2,4-dien-1-yl]propan-1-imine |
| SMILES | [H]/N=C/C(C)C1C=CC=C(C(F)(F)F)C1 |
| InChI | InChI=1S/C10H12F3N/c1-7(6-14)8-3-2-4-9(5-8)10(11,12)13/h2-4,6-8,14H,5H2,1H3/b14-6+ |
| InChIKey | YYAQGLNGQHOUID-MKMNVTDBSA-N |
| XLogP | 3.34 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.21 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|