C13H21FN2 — CID 163413862
(2S,5Z,8E)-8-fluoro-2-methanimidoyl-7-methyl-4-methylidenedeca-5,8-dien-1-amine (PubChem CID 163413862) has the molecular formula C13H21FN2 and a molecular weight of 224.32 g/mol. Its IUPAC name is (2S,5Z,8E)-8-fluoro-2-methanimidoyl-7-methyl-4-methylidenedeca-5,8-dien-1-amine.
| Compound Name | (2S,5Z,8E)-8-fluoro-2-methanimidoyl-7-methyl-4-methylidenedeca-5,8-dien-1-amine |
|---|---|
| PubChem CID | 163413862 |
| Molecular Formula | C13H21FN2 |
| Molecular Weight | 224.32 g/mol |
| Exact Mass | 224.17 |
| IUPAC Name | (2S,5Z,8E)-8-fluoro-2-methanimidoyl-7-methyl-4-methylidenedeca-5,8-dien-1-amine |
| SMILES | [H]/N=C/[C@H](CN)CC(=C)/C=C\C(C)/C(F)=C\C |
| InChI | InChI=1S/C13H21FN2/c1-4-13(14)11(3)6-5-10(2)7-12(8-15)9-16/h4-6,8,11-12,15H,2,7,9,16H2,1,3H3/b6-5-,13-4+,15-8+/t11?,12-/m1/s1 |
| InChIKey | ACTAQCRTHOGANE-BWIRKDQQSA-N |
| XLogP | 3.22 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.32 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|