C10H18N2 — CID 176964311
(5Z)-5-methanimidoyl-4-methylocta-5,7-dien-1-amine (PubChem CID 176964311) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is (5Z)-5-methanimidoyl-4-methylocta-5,7-dien-1-amine.
| Compound Name | (5Z)-5-methanimidoyl-4-methylocta-5,7-dien-1-amine |
|---|---|
| PubChem CID | 176964311 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | (5Z)-5-methanimidoyl-4-methylocta-5,7-dien-1-amine |
| SMILES | [H]/N=C/C(=C\C=C)C(C)CCCN |
| InChI | InChI=1S/C10H18N2/c1-3-5-10(8-12)9(2)6-4-7-11/h3,5,8-9,12H,1,4,6-7,11H2,2H3/b10-5+,12-8+ |
| InChIKey | FTODKIGQMARDTI-ULERAKTPSA-N |
| XLogP | 2.12 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|