C9H16N2 — CID 123670318
(4Z)-4-(2-iminoethyl)hepta-4,6-dien-1-amine (PubChem CID 123670318) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is (4Z)-4-(2-iminoethyl)hepta-4,6-dien-1-amine.
| Compound Name | (4Z)-4-(2-iminoethyl)hepta-4,6-dien-1-amine |
|---|---|
| PubChem CID | 123670318 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | (4Z)-4-(2-iminoethyl)hepta-4,6-dien-1-amine |
| SMILES | [H]/N=C/C/C(=C\C=C)CCCN |
| InChI | InChI=1S/C9H16N2/c1-2-4-9(6-8-11)5-3-7-10/h2,4,8,11H,1,3,5-7,10H2/b9-4-,11-8+ |
| InChIKey | NIFLANIAZKRLHD-GVXASNAJSA-N |
| XLogP | 1.88 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|