C14H19N — CID 91151318
4-(7-methylcyclohepta-2,4-dien-1-yl)-2-methylidenepent-3-en-1-imine (PubChem CID 91151318) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is 4-(7-methylcyclohepta-2,4-dien-1-yl)-2-methylidenepent-3-en-1-imine.
| Compound Name | 4-(7-methylcyclohepta-2,4-dien-1-yl)-2-methylidenepent-3-en-1-imine |
|---|---|
| PubChem CID | 91151318 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 4-(7-methylcyclohepta-2,4-dien-1-yl)-2-methylidenepent-3-en-1-imine |
| SMILES | [H]/N=C/C(=C)C=C(C)C1C=CC=CCC1C |
| InChI | InChI=1S/C14H19N/c1-11(10-15)9-13(3)14-8-6-4-5-7-12(14)2/h4-6,8-10,12,14-15H,1,7H2,2-3H3/b13-9?,15-10+ |
| InChIKey | OTYLAZMITAVTAI-WAGGCFASSA-N |
| XLogP | 3.91 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|