C12H17N — CID 91615402
4-cyclohexa-2,4-dien-1-yl-2-methylpent-3-en-1-imine (PubChem CID 91615402) has the molecular formula C12H17N and a molecular weight of 175.28 g/mol. Its IUPAC name is 4-cyclohexa-2,4-dien-1-yl-2-methylpent-3-en-1-imine.
| Compound Name | 4-cyclohexa-2,4-dien-1-yl-2-methylpent-3-en-1-imine |
|---|---|
| PubChem CID | 91615402 |
| Molecular Formula | C12H17N |
| Molecular Weight | 175.28 g/mol |
| Exact Mass | 175.14 |
| IUPAC Name | 4-cyclohexa-2,4-dien-1-yl-2-methylpent-3-en-1-imine |
| SMILES | [H]/N=C/C(C)C=C(C)C1C=CC=CC1 |
| InChI | InChI=1S/C12H17N/c1-10(9-13)8-11(2)12-6-4-3-5-7-12/h3-6,8-10,12-13H,7H2,1-2H3/b11-8?,13-9+ |
| InChIKey | LTCLMKBSHCFOFI-JGVUFJOKSA-N |
| XLogP | 3.35 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.28 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|