C9H11N — CID 57147783
7-bicyclo[4.2.0]octa-3,5-dienylmethanimine (PubChem CID 57147783) has the molecular formula C9H11N and a molecular weight of 133.19 g/mol. Its IUPAC name is 7-bicyclo[4.2.0]octa-3,5-dienylmethanimine.
| Compound Name | 7-bicyclo[4.2.0]octa-3,5-dienylmethanimine |
|---|---|
| PubChem CID | 57147783 |
| Molecular Formula | C9H11N |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.09 |
| IUPAC Name | 7-bicyclo[4.2.0]octa-3,5-dienylmethanimine |
| SMILES | [H]/N=C/C1CC2CC=CC=C12 |
| InChI | InChI=1S/C9H11N/c10-6-8-5-7-3-1-2-4-9(7)8/h1-2,4,6-8,10H,3,5H2/b10-6+ |
| InChIKey | QLBXRAQLLYPCHO-UXBLZVDNSA-N |
| XLogP | 2.16 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|