C13H19N — CID 88562249
[2-ethyl-3-methyl-3-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine (PubChem CID 88562249) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is [2-ethyl-3-methyl-3-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine.
| Compound Name | [2-ethyl-3-methyl-3-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine |
|---|---|
| PubChem CID | 88562249 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | [2-ethyl-3-methyl-3-[(Z)-prop-1-enyl]cyclohexa-1,5-dien-1-yl]methanimine |
| SMILES | [H]/N=C/C1=C(CC)C(C)(/C=C\C)CC=C1 |
| InChI | InChI=1S/C13H19N/c1-4-8-13(3)9-6-7-11(10-14)12(13)5-2/h4,6-8,10,14H,5,9H2,1-3H3/b8-4-,14-10+ |
| InChIKey | PTEIHOBBNCAZCQ-PZIMUTROSA-N |
| XLogP | 3.88 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|