C20H29N — CID 54391338
3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 54391338) has the molecular formula C20H29N and a molecular weight of 283.46 g/mol. Its IUPAC name is 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 54391338 |
| Molecular Formula | C20H29N |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.23 |
| IUPAC Name | 3,7-dimethyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | [H]/N=C/C=C(C)C=CC=C(C)C=CC1=C(C)CCCC1(C)C |
| InChI | InChI=1S/C20H29N/c1-16(8-6-9-17(2)13-15-21)11-12-19-18(3)10-7-14-20(19,4)5/h6,8-9,11-13,15,21H,7,10,14H2,1-5H3/b9-6?,12-11?,16-8?,17-13?,21-15+ |
| InChIKey | VGVRTZOYKRWJLY-XSYNOWCXSA-N |
| XLogP | 6.17 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|