C27H43N — CID 14078328
(2E,4E,6E,8E)-N-butyl-3-tert-butyl-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine (PubChem CID 14078328) has the molecular formula C27H43N and a molecular weight of 381.65 g/mol. Its IUPAC name is (2E,4E,6E,8E)-N-butyl-3-tert-butyl-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine.
| Compound Name | (2E,4E,6E,8E)-N-butyl-3-tert-butyl-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
|---|---|
| PubChem CID | 14078328 |
| Molecular Formula | C27H43N |
| Molecular Weight | 381.65 g/mol |
| Exact Mass | 381.34 |
| IUPAC Name | (2E,4E,6E,8E)-N-butyl-3-tert-butyl-7-methyl-9-(2,6,6-trimethylcyclohexen-1-yl)nona-2,4,6,8-tetraen-1-imine |
| SMILES | CCCC/N=C\C=C(/C=C/C=C(C)/C=C/C1=C(C)CCCC1(C)C)C(C)(C)C |
| InChI | InChI=1S/C27H43N/c1-9-10-20-28-21-18-24(26(4,5)6)15-11-13-22(2)16-17-25-23(3)14-12-19-27(25,7)8/h11,13,15-18,21H,9-10,12,14,19-20H2,1-8H3/b15-11+,17-16+,22-13+,24-18+,28-21- |
| InChIKey | HOISDWCQGLLAHR-ZNWKKSJZSA-N |
| XLogP | 8.42 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.65 |
| LogP ≤ 5 | 8.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|