C20H33F2N — CID 134305891
(Z)-3-[5-(1,1-difluoroethyl)-5-methylcyclohexen-1-yl]-N-methyldec-2-en-1-imine (PubChem CID 134305891) has the molecular formula C20H33F2N and a molecular weight of 325.49 g/mol. Its IUPAC name is (Z)-3-[5-(1,1-difluoroethyl)-5-methylcyclohexen-1-yl]-N-methyldec-2-en-1-imine.
| Compound Name | (Z)-3-[5-(1,1-difluoroethyl)-5-methylcyclohexen-1-yl]-N-methyldec-2-en-1-imine |
|---|---|
| PubChem CID | 134305891 |
| Molecular Formula | C20H33F2N |
| Molecular Weight | 325.49 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | (Z)-3-[5-(1,1-difluoroethyl)-5-methylcyclohexen-1-yl]-N-methyldec-2-en-1-imine |
| SMILES | CCCCCCC/C(=C/C=N/C)C1=CCCC(C)(C(C)(F)F)C1 |
| InChI | InChI=1S/C20H33F2N/c1-5-6-7-8-9-11-17(13-15-23-4)18-12-10-14-19(2,16-18)20(3,21)22/h12-13,15H,5-11,14,16H2,1-4H3/b17-13-,23-15+ |
| InChIKey | CRECVYLLCPLCDL-BWLYTCHZSA-N |
| XLogP | 6.75 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.49 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|