C17H26O5 — CID 101465745
dimethyl 3-hexanoylcyclohept-3-ene-1,1-dicarboxylate (PubChem CID 101465745) has the molecular formula C17H26O5 and a molecular weight of 310.39 g/mol. Its IUPAC name is dimethyl 3-hexanoylcyclohept-3-ene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-hexanoylcyclohept-3-ene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 101465745 |
| Molecular Formula | C17H26O5 |
| Molecular Weight | 310.39 g/mol |
| Exact Mass | 310.18 |
| IUPAC Name | dimethyl 3-hexanoylcyclohept-3-ene-1,1-dicarboxylate |
| SMILES | CCCCCC(=O)C1=CCCCC(C(=O)OC)(C(=O)OC)C1 |
| InChI | InChI=1S/C17H26O5/c1-4-5-6-10-14(18)13-9-7-8-11-17(12-13,15(19)21-2)16(20)22-3/h9H,4-8,10-12H2,1-3H3 |
| InChIKey | WPPRQZJCYJMLPD-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.39 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|