C19H29IO4 — CID 12033471
dimethyl (3aR,6aS)-5-(1-iodoheptylidene)-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate (PubChem CID 12033471) has the molecular formula C19H29IO4 and a molecular weight of 448.34 g/mol. Its IUPAC name is dimethyl (3aR,6aS)-5-(1-iodoheptylidene)-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate.
| Compound Name | dimethyl (3aR,6aS)-5-(1-iodoheptylidene)-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
|---|---|
| PubChem CID | 12033471 |
| Molecular Formula | C19H29IO4 |
| Molecular Weight | 448.34 g/mol |
| Exact Mass | 448.11 |
| IUPAC Name | dimethyl (3aR,6aS)-5-(1-iodoheptylidene)-1,3,3a,4,6,6a-hexahydropentalene-2,2-dicarboxylate |
| SMILES | CCCCCC/C(I)=C1/C[C@@H]2CC(C(=O)OC)(C(=O)OC)C[C@@H]2C1 |
| InChI | InChI=1S/C19H29IO4/c1-4-5-6-7-8-16(20)13-9-14-11-19(17(21)23-2,18(22)24-3)12-15(14)10-13/h14-15H,4-12H2,1-3H3/b16-13-/t14-,15+/m0/s1 |
| InChIKey | LKCLQZKDAIVNJW-HRVKVGKRSA-N |
| XLogP | 4.80 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.34 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|