C21H40O4Si — CID 102006866
trans-dimethyl (3S,4S)-3-pentyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 102006866) has the molecular formula C21H40O4Si and a molecular weight of 384.63 g/mol. Its IUPAC name is trans-dimethyl (3S,4S)-3-pentyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4S)-3-pentyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 102006866 |
| Molecular Formula | C21H40O4Si |
| Molecular Weight | 384.63 g/mol |
| Exact Mass | 384.27 |
| IUPAC Name | trans-dimethyl (3S,4S)-3-pentyl-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CCCCC[C@H]1CC(C(=O)OC)(C(=O)OC)C[C@@H]1C[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H40O4Si/c1-7-11-12-13-17-14-21(19(22)24-5,20(23)25-6)15-18(17)16-26(8-2,9-3)10-4/h17-18H,7-16H2,1-6H3/t17-,18+/m0/s1 |
| InChIKey | QLAXXPGBPJKMHM-ZWKOTPCHSA-N |
| XLogP | 5.43 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.63 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|