C24H48O4Si2 — CID 10671515
trans-dimethyl (3S,4R)-3-(2-triethylsilylethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 10671515) has the molecular formula C24H48O4Si2 and a molecular weight of 456.82 g/mol. Its IUPAC name is trans-dimethyl (3S,4R)-3-(2-triethylsilylethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4R)-3-(2-triethylsilylethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10671515 |
| Molecular Formula | C24H48O4Si2 |
| Molecular Weight | 456.82 g/mol |
| Exact Mass | 456.31 |
| IUPAC Name | trans-dimethyl (3S,4R)-3-(2-triethylsilylethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CC[Si](CC)(CC)CC[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@H]1C[Si](CC)(CC)CC |
| InChI | InChI=1S/C24H48O4Si2/c1-9-29(10-2,11-3)16-15-20-17-24(22(25)27-7,23(26)28-8)18-21(20)19-30(12-4,13-5)14-6/h20-21H,9-19H2,1-8H3/t20-,21+/m1/s1 |
| InChIKey | KHARSQHQJDXYMX-RTWAWAEBSA-N |
| XLogP | 6.75 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.82 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|