C19H34O6Si — CID 10500383
trans-dimethyl (3S,4R)-3-(2-methoxy-2-oxoethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate (PubChem CID 10500383) has the molecular formula C19H34O6Si and a molecular weight of 386.56 g/mol. Its IUPAC name is trans-dimethyl (3S,4R)-3-(2-methoxy-2-oxoethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate.
| Compound Name | trans-dimethyl (3S,4R)-3-(2-methoxy-2-oxoethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10500383 |
| Molecular Formula | C19H34O6Si |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.21 |
| IUPAC Name | trans-dimethyl (3S,4R)-3-(2-methoxy-2-oxoethyl)-4-(triethylsilylmethyl)cyclopentane-1,1-dicarboxylate |
| SMILES | CC[Si](CC)(CC)C[C@@H]1CC(C(=O)OC)(C(=O)OC)C[C@H]1CC(=O)OC |
| InChI | InChI=1S/C19H34O6Si/c1-7-26(8-2,9-3)13-15-12-19(17(21)24-5,18(22)25-6)11-14(15)10-16(20)23-4/h14-15H,7-13H2,1-6H3/t14-,15+/m1/s1 |
| InChIKey | BOILQZJLPBIFAI-CABCVRRESA-N |
| XLogP | 3.42 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|