C24H48O6Si4 — CID 10745132
dimethyl 3-(2-methoxy-2-oxoethyl)-4-[(E)-3-tris(trimethylsilyl)silylprop-1-enyl]cyclopentane-1,1-dicarboxylate (PubChem CID 10745132) has the molecular formula C24H48O6Si4 and a molecular weight of 544.99 g/mol. Its IUPAC name is dimethyl 3-(2-methoxy-2-oxoethyl)-4-[(E)-3-tris(trimethylsilyl)silylprop-1-enyl]cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(2-methoxy-2-oxoethyl)-4-[(E)-3-tris(trimethylsilyl)silylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10745132 |
| Molecular Formula | C24H48O6Si4 |
| Molecular Weight | 544.99 g/mol |
| Exact Mass | 544.25 |
| IUPAC Name | dimethyl 3-(2-methoxy-2-oxoethyl)-4-[(E)-3-tris(trimethylsilyl)silylprop-1-enyl]cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)CC1CC(C(=O)OC)(C(=O)OC)CC1/C=C/C[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H48O6Si4/c1-28-21(25)16-20-18-24(22(26)29-2,23(27)30-3)17-19(20)14-13-15-34(31(4,5)6,32(7,8)9)33(10,11)12/h13-14,19-20H,15-18H2,1-12H3/b14-13+ |
| InChIKey | YJBIULKTQVTGCW-BUHFOSPRSA-N |
| XLogP | 5.16 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.99 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|