C15H24O5 — CID 51031098
dimethyl (3R,4R,5S)-3-hydroxy-4-methyl-5-(2-methylprop-1-enyl)cyclohexane-1,1-dicarboxylate (PubChem CID 51031098) has the molecular formula C15H24O5 and a molecular weight of 284.35 g/mol. Its IUPAC name is dimethyl (3R,4R,5S)-3-hydroxy-4-methyl-5-(2-methylprop-1-enyl)cyclohexane-1,1-dicarboxylate.
| Compound Name | dimethyl (3R,4R,5S)-3-hydroxy-4-methyl-5-(2-methylprop-1-enyl)cyclohexane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 51031098 |
| Molecular Formula | C15H24O5 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.16 |
| IUPAC Name | dimethyl (3R,4R,5S)-3-hydroxy-4-methyl-5-(2-methylprop-1-enyl)cyclohexane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C[C@@H](O)[C@H](C)[C@H](C=C(C)C)C1 |
| InChI | InChI=1S/C15H24O5/c1-9(2)6-11-7-15(13(17)19-4,14(18)20-5)8-12(16)10(11)3/h6,10-12,16H,7-8H2,1-5H3/t10-,11-,12-/m1/s1 |
| InChIKey | NGWHRZJIHOMVOP-IJLUTSLNSA-N |
| XLogP | 1.69 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|