C20H24O8 — CID 73407881
tetramethyl 1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate (PubChem CID 73407881) has the molecular formula C20H24O8 and a molecular weight of 392.40 g/mol. Its IUPAC name is tetramethyl 1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate.
| Compound Name | tetramethyl 1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 73407881 |
| Molecular Formula | C20H24O8 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | tetramethyl 1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=CC=C3CC(C(=O)OC)(C(=O)OC)CC3C2C1 |
| InChI | InChI=1S/C20H24O8/c1-25-15(21)19(16(22)26-2)7-11-5-6-12-8-20(17(23)27-3,18(24)28-4)10-14(12)13(11)9-19/h5-6,13-14H,7-10H2,1-4H3 |
| InChIKey | WPQJXEMSNCTRSN-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.40 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|