C16H26O5 — CID 10881064
dimethyl (3R)-3-(2-methoxypropan-2-yl)-4-propan-2-ylidenecyclopentane-1,1-dicarboxylate (PubChem CID 10881064) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is dimethyl (3R)-3-(2-methoxypropan-2-yl)-4-propan-2-ylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3R)-3-(2-methoxypropan-2-yl)-4-propan-2-ylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 10881064 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | dimethyl (3R)-3-(2-methoxypropan-2-yl)-4-propan-2-ylidenecyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(=C(C)C)[C@H](C(C)(C)OC)C1 |
| InChI | InChI=1S/C16H26O5/c1-10(2)11-8-16(13(17)19-5,14(18)20-6)9-12(11)15(3,4)21-7/h12H,8-9H2,1-7H3/t12-/m1/s1 |
| InChIKey | HCMDPXAUPBPFOH-GFCCVEGCSA-N |
| XLogP | 2.49 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|