C32H32O8 — CID 135054695
tetramethyl (8aS,8bS)-4,5-diphenyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate (PubChem CID 135054695) has the molecular formula C32H32O8 and a molecular weight of 544.60 g/mol. Its IUPAC name is tetramethyl (8aS,8bS)-4,5-diphenyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate.
| Compound Name | tetramethyl (8aS,8bS)-4,5-diphenyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate |
|---|---|
| PubChem CID | 135054695 |
| Molecular Formula | C32H32O8 |
| Molecular Weight | 544.60 g/mol |
| Exact Mass | 544.21 |
| IUPAC Name | tetramethyl (8aS,8bS)-4,5-diphenyl-1,3,6,8,8a,8b-hexahydro-as-indacene-2,2,7,7-tetracarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC2=C(c3ccccc3)C(c3ccccc3)=C3CC(C(=O)OC)(C(=O)OC)C[C@H]3[C@@H]2C1 |
| InChI | InChI=1S/C32H32O8/c1-37-27(33)31(28(34)38-2)15-21-22-16-32(29(35)39-3,30(36)40-4)18-24(22)26(20-13-9-6-10-14-20)25(23(21)17-31)19-11-7-5-8-12-19/h5-14,21-22H,15-18H2,1-4H3/t21-,22-/m0/s1 |
| InChIKey | QTBZEZDNXZXMGL-VXKWHMMOSA-N |
| XLogP | 4.39 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|