C17H20O5 — CID 11392540
dimethyl (3R)-3-[(S)-hydroxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate (PubChem CID 11392540) has the molecular formula C17H20O5 and a molecular weight of 304.34 g/mol. Its IUPAC name is dimethyl (3R)-3-[(S)-hydroxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (3R)-3-[(S)-hydroxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 11392540 |
| Molecular Formula | C17H20O5 |
| Molecular Weight | 304.34 g/mol |
| Exact Mass | 304.13 |
| IUPAC Name | dimethyl (3R)-3-[(S)-hydroxy(phenyl)methyl]-4-methylidenecyclopentane-1,1-dicarboxylate |
| SMILES | C=C1CC(C(=O)OC)(C(=O)OC)C[C@H]1[C@H](O)c1ccccc1 |
| InChI | InChI=1S/C17H20O5/c1-11-9-17(15(19)21-2,16(20)22-3)10-13(11)14(18)12-7-5-4-6-8-12/h4-8,13-14,18H,1,9-10H2,2-3H3/t13-,14-/m1/s1 |
| InChIKey | WGASFVRWFSOFMJ-ZIAGYGMSSA-N |
| XLogP | 2.02 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.34 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|