C20H24O4 — CID 15940750
dimethyl (4Z)-3-ethenyl-4-(1-phenylpropylidene)cyclopentane-1,1-dicarboxylate (PubChem CID 15940750) has the molecular formula C20H24O4 and a molecular weight of 328.41 g/mol. Its IUPAC name is dimethyl (4Z)-3-ethenyl-4-(1-phenylpropylidene)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl (4Z)-3-ethenyl-4-(1-phenylpropylidene)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 15940750 |
| Molecular Formula | C20H24O4 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.17 |
| IUPAC Name | dimethyl (4Z)-3-ethenyl-4-(1-phenylpropylidene)cyclopentane-1,1-dicarboxylate |
| SMILES | C=CC1CC(C(=O)OC)(C(=O)OC)C/C1=C(\CC)c1ccccc1 |
| InChI | InChI=1S/C20H24O4/c1-5-14-12-20(18(21)23-3,19(22)24-4)13-17(14)16(6-2)15-10-8-7-9-11-15/h5,7-11,14H,1,6,12-13H2,2-4H3/b17-16- |
| InChIKey | NDGRJLNGJJJMAI-MSUUIHNZSA-N |
| XLogP | 3.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|