C14H15NO3 — CID 102145889
cis-methyl (1R,2R)-1-benzamido-2-ethenylcyclopropane-1-carboxylate (PubChem CID 102145889) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is cis-methyl (1R,2R)-1-benzamido-2-ethenylcyclopropane-1-carboxylate.
| Compound Name | cis-methyl (1R,2R)-1-benzamido-2-ethenylcyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 102145889 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | cis-methyl (1R,2R)-1-benzamido-2-ethenylcyclopropane-1-carboxylate |
| SMILES | C=C[C@H]1C[C@]1(NC(=O)c1ccccc1)C(=O)OC |
| InChI | InChI=1S/C14H15NO3/c1-3-11-9-14(11,13(17)18-2)15-12(16)10-7-5-4-6-8-10/h3-8,11H,1,9H2,2H3,(H,15,16)/t11-,14+/m0/s1 |
| InChIKey | RMZOJROCNHLLHA-SMDDNHRTSA-N |
| XLogP | 1.53 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|