C23H34N2O6 — CID 159332995
methane;methyl 2-(benzylideneamino)acetate;trans-methyl (1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate (PubChem CID 159332995) has the molecular formula C23H34N2O6 and a molecular weight of 434.53 g/mol. Its IUPAC name is methane;methyl 2-(benzylideneamino)acetate;trans-methyl (1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate.
| Compound Name | methane;methyl 2-(benzylideneamino)acetate;trans-methyl (1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 159332995 |
| Molecular Formula | C23H34N2O6 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.24 |
| IUPAC Name | methane;methyl 2-(benzylideneamino)acetate;trans-methyl (1R,2S)-2-ethenyl-1-[(2-methylpropan-2-yl)oxycarbonylamino]cyclopropane-1-carboxylate |
| SMILES | C.C=C[C@@H]1C[C@]1(NC(=O)OC(C)(C)C)C(=O)OC.COC(=O)C/N=C/c1ccccc1 |
| InChI | InChI=1S/C12H19NO4.C10H11NO2.CH4/c1-6-8-7-12(8,9(14)16-5)13-10(15)17-11(2,3)4;1-13-10(12)8-11-7-9-5-3-2-4-6-9;/h6,8H,1,7H2,2-5H3,(H,13,15);2-7H,8H2,1H3;1H4/b;11-7+;/t8-,12-;;/m1../s1 |
| InChIKey | LFEMCNJSNUWCNK-ANPJCOKGSA-N |
| XLogP | 3.54 |
| TPSA | 103.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|