C11H13N3O3 — CID 66742386
trans-methyl (1R,2S)-2-ethenyl-1-(imidazole-1-carbonylamino)cyclopropane-1-carboxylate (PubChem CID 66742386) has the molecular formula C11H13N3O3 and a molecular weight of 235.24 g/mol. Its IUPAC name is trans-methyl (1R,2S)-2-ethenyl-1-(imidazole-1-carbonylamino)cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-2-ethenyl-1-(imidazole-1-carbonylamino)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 66742386 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | trans-methyl (1R,2S)-2-ethenyl-1-(imidazole-1-carbonylamino)cyclopropane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)n1ccnc1)C(=O)OC |
| InChI | InChI=1S/C11H13N3O3/c1-3-8-6-11(8,9(15)17-2)13-10(16)14-5-4-12-7-14/h3-5,7-8H,1,6H2,2H3,(H,13,16)/t8-,11-/m1/s1 |
| InChIKey | PWODCCMCCYPXMX-LDYMZIIASA-N |
| XLogP | 0.56 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|