C9H10F3NO3 — CID 58938983
trans-methyl (1R,2S)-2-ethenyl-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxylate (PubChem CID 58938983) has the molecular formula C9H10F3NO3 and a molecular weight of 237.18 g/mol. Its IUPAC name is trans-methyl (1R,2S)-2-ethenyl-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxylate.
| Compound Name | trans-methyl (1R,2S)-2-ethenyl-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 58938983 |
| Molecular Formula | C9H10F3NO3 |
| Molecular Weight | 237.18 g/mol |
| Exact Mass | 237.06 |
| IUPAC Name | trans-methyl (1R,2S)-2-ethenyl-1-[(2,2,2-trifluoroacetyl)amino]cyclopropane-1-carboxylate |
| SMILES | C=C[C@@H]1C[C@]1(NC(=O)C(F)(F)F)C(=O)OC |
| InChI | InChI=1S/C9H10F3NO3/c1-3-5-4-8(5,7(15)16-2)13-6(14)9(10,11)12/h3,5H,1,4H2,2H3,(H,13,14)/t5-,8-/m1/s1 |
| InChIKey | IGSXQEAOAVGYBW-SVGQVSJJSA-N |
| XLogP | 0.78 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.18 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|