About cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene
cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene (PubChem CID 144871920) has the molecular formula C18H36N2O2
and a molecular weight of 312.50 g/mol. Its IUPAC name is cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene.
Molecular Properties
| Compound Name | cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene |
| PubChem CID | 144871920 |
| Molecular Formula | C18H36N2O2 |
| Molecular Weight | 312.50 g/mol |
| Exact Mass | 312.28 |
| IUPAC Name | cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene |
| SMILES | C=CCCC.CC.CC.CC.O=C(OC1CC1)n1ccnc1 |
| InChI | InChI=1S/C7H8N2O2.C5H10.3C2H6/c10-7(11-6-1-2-6)9-4-3-8-5-9;1-3-5-4-2;3*1-2/h3-6H,1-2H2;3H,1,4-5H2,2H3;3*1-2H3 |
| InChIKey | POHDUTOTYDIOQI-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 312.50 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene?
The IUPAC name of cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene (CID 144871920) is cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene.
What is the SMILES notation for cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene?
The canonical SMILES for cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene is C=CCCC.CC.CC.CC.O=C(OC1CC1)n1ccnc1.
What is the InChIKey of cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene?
The InChIKey is POHDUTOTYDIOQI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N2O2.C5H10.3C2H6/c10-7(11-6-1-2-6)9-4-3-8-5-9;1-3-5-4-2;3*1-2/h3-6H,1-2H2;3H,1,4-5H2,2H3;3*1-2H3.
What are the key properties of cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene?
cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene has a molecular weight of 312.50 g/mol, XLogP of 6.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropyl imidazole-1-carboxylate;ethane;pent-1-ene is sourced from PubChem (CID 144871920), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).