C11H18N2O — CID 143773294
buta-1,3-diene;ethane;1-imidazol-1-ylethanone (PubChem CID 143773294) has the molecular formula C11H18N2O and a molecular weight of 194.28 g/mol. Its IUPAC name is buta-1,3-diene;ethane;1-imidazol-1-ylethanone.
| Compound Name | buta-1,3-diene;ethane;1-imidazol-1-ylethanone |
|---|---|
| PubChem CID | 143773294 |
| Molecular Formula | C11H18N2O |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.14 |
| IUPAC Name | buta-1,3-diene;ethane;1-imidazol-1-ylethanone |
| SMILES | C=CC=C.CC.CC(=O)n1ccnc1 |
| InChI | InChI=1S/C5H6N2O.C4H6.C2H6/c1-5(8)7-3-2-6-4-7;1-3-4-2;1-2/h2-4H,1H3;3-4H,1-2H2;1-2H3 |
| InChIKey | ULERQEPZWLRXQM-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|