C6H6N2S2 — CID 87350552
1-imidazol-1-ylpropane-1,2-dithione (PubChem CID 87350552) has the molecular formula C6H6N2S2 and a molecular weight of 170.26 g/mol. Its IUPAC name is 1-imidazol-1-ylpropane-1,2-dithione.
| Compound Name | 1-imidazol-1-ylpropane-1,2-dithione |
|---|---|
| PubChem CID | 87350552 |
| Molecular Formula | C6H6N2S2 |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.00 |
| IUPAC Name | 1-imidazol-1-ylpropane-1,2-dithione |
| SMILES | CC(=S)C(=S)n1ccnc1 |
| InChI | InChI=1S/C6H6N2S2/c1-5(9)6(10)8-3-2-7-4-8/h2-4H,1H3 |
| InChIKey | CFRQMNDWJNIESX-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|