potassium imidazole-1-carbodithioate

C4H3KN2S2 — CID 102210808

IUPACpotassium imidazole-1-carbodithioate
SMILESS=C([S-])n1ccnc1.[K+]
InChIInChI=1S/C4H4N2S2.K/c7-4(8)6-2-1-5-3-6;/h1-3H,(H,7,8);/q;+1/p-1
InChIKeyJXVMTTJOCVAMJL-UHFFFAOYSA-M
MW182.31 g/mol
LogP-2.43
Rot. Bonds

About potassium imidazole-1-carbodithioate

potassium imidazole-1-carbodithioate (PubChem CID 102210808) has the molecular formula C4H3KN2S2 and a molecular weight of 182.31 g/mol. Its IUPAC name is potassium imidazole-1-carbodithioate.

Molecular Properties

Compound Namepotassium imidazole-1-carbodithioate
PubChem CID102210808
Molecular FormulaC4H3KN2S2
Molecular Weight182.31 g/mol
Exact Mass181.94
IUPAC Namepotassium imidazole-1-carbodithioate
SMILESS=C([S-])n1ccnc1.[K+]
InChIInChI=1S/C4H4N2S2.K/c7-4(8)6-2-1-5-3-6;/h1-3H,(H,7,8);/q;+1/p-1
InChIKeyJXVMTTJOCVAMJL-UHFFFAOYSA-M
XLogP-2.43
TPSA17.82 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms9
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.31
LogP ≤ 5-2.43
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'}

Analyze potassium imidazole-1-carbodithioate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of potassium imidazole-1-carbodithioate?
The IUPAC name of potassium imidazole-1-carbodithioate (CID 102210808) is potassium imidazole-1-carbodithioate.
What is the SMILES notation for potassium imidazole-1-carbodithioate?
The canonical SMILES for potassium imidazole-1-carbodithioate is S=C([S-])n1ccnc1.[K+].
What is the InChIKey of potassium imidazole-1-carbodithioate?
The InChIKey is JXVMTTJOCVAMJL-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H4N2S2.K/c7-4(8)6-2-1-5-3-6;/h1-3H,(H,7,8);/q;+1/p-1.
What are the key properties of potassium imidazole-1-carbodithioate?
potassium imidazole-1-carbodithioate has a molecular weight of 182.31 g/mol, XLogP of -2.43, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for potassium imidazole-1-carbodithioate is sourced from PubChem (CID 102210808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).