About 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole
1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole (PubChem CID 119084004) has the molecular formula C5H3ClF2N2
and a molecular weight of 164.54 g/mol. Its IUPAC name is 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole.
Molecular Properties
| Compound Name | 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole |
| PubChem CID | 119084004 |
| Molecular Formula | C5H3ClF2N2 |
| Molecular Weight | 164.54 g/mol |
| Exact Mass | 164.00 |
| IUPAC Name | 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole |
| SMILES | F/C(Cl)=C(/F)n1ccnc1 |
| InChI | InChI=1S/C5H3ClF2N2/c6-4(7)5(8)10-2-1-9-3-10/h1-3H/b5-4- |
| InChIKey | OVFWIKSIWTWFTP-PLNGDYQASA-N |
| XLogP | 2.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole?
The IUPAC name of 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole (CID 119084004) is 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole.
What is the SMILES notation for 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole?
The canonical SMILES for 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole is F/C(Cl)=C(/F)n1ccnc1.
What is the InChIKey of 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole?
The InChIKey is OVFWIKSIWTWFTP-PLNGDYQASA-N. The full InChI is InChI=1S/C5H3ClF2N2/c6-4(7)5(8)10-2-1-9-3-10/h1-3H/b5-4-.
What are the key properties of 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole?
1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole has a molecular weight of 164.54 g/mol, XLogP of 2.14, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(Z)-2-chloro-1,2-difluoroethenyl]imidazole is sourced from PubChem (CID 119084004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).