C12H14N4O2 — CID 14413796
1,6-di(imidazol-1-yl)hexane-1,6-dione (PubChem CID 14413796) has the molecular formula C12H14N4O2 and a molecular weight of 246.27 g/mol. Its IUPAC name is 1,6-di(imidazol-1-yl)hexane-1,6-dione.
| Compound Name | 1,6-di(imidazol-1-yl)hexane-1,6-dione |
|---|---|
| PubChem CID | 14413796 |
| Molecular Formula | C12H14N4O2 |
| Molecular Weight | 246.27 g/mol |
| Exact Mass | 246.11 |
| IUPAC Name | 1,6-di(imidazol-1-yl)hexane-1,6-dione |
| SMILES | O=C(CCCCC(=O)n1ccnc1)n1ccnc1 |
| InChI | InChI=1S/C12H14N4O2/c17-11(15-7-5-13-9-15)3-1-2-4-12(18)16-8-6-14-10-16/h5-10H,1-4H2 |
| InChIKey | AKNVYRYHIRWZTN-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 69.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.27 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|