C10H12F2N2O2S — CID 163596553
4-(3,3-difluoro-3-sulfanylprop-1-en-2-yl)oxy-1-imidazol-1-ylbutan-1-one (PubChem CID 163596553) has the molecular formula C10H12F2N2O2S and a molecular weight of 262.28 g/mol. Its IUPAC name is 4-(3,3-difluoro-3-sulfanylprop-1-en-2-yl)oxy-1-imidazol-1-ylbutan-1-one.
| Compound Name | 4-(3,3-difluoro-3-sulfanylprop-1-en-2-yl)oxy-1-imidazol-1-ylbutan-1-one |
|---|---|
| PubChem CID | 163596553 |
| Molecular Formula | C10H12F2N2O2S |
| Molecular Weight | 262.28 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | 4-(3,3-difluoro-3-sulfanylprop-1-en-2-yl)oxy-1-imidazol-1-ylbutan-1-one |
| SMILES | C=C(OCCCC(=O)n1ccnc1)C(F)(F)S |
| InChI | InChI=1S/C10H12F2N2O2S/c1-8(10(11,12)17)16-6-2-3-9(15)14-5-4-13-7-14/h4-5,7,17H,1-3,6H2 |
| InChIKey | GTYASPTYIKKGBL-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 44.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|