About imidazole-1-carboxamide;propan-2-ol
imidazole-1-carboxamide;propan-2-ol (PubChem CID 121360857) has the molecular formula C7H13N3O2
and a molecular weight of 171.20 g/mol. Its IUPAC name is imidazole-1-carboxamide;propan-2-ol.
Molecular Properties
| Compound Name | imidazole-1-carboxamide;propan-2-ol |
| PubChem CID | 121360857 |
| Molecular Formula | C7H13N3O2 |
| Molecular Weight | 171.20 g/mol |
| Exact Mass | 171.10 |
| IUPAC Name | imidazole-1-carboxamide;propan-2-ol |
| SMILES | CC(C)O.NC(=O)n1ccnc1 |
| InChI | InChI=1S/C4H5N3O.C3H8O/c5-4(8)7-2-1-6-3-7;1-3(2)4/h1-3H,(H2,5,8);3-4H,1-2H3 |
| InChIKey | QLDXFVPFINWQNR-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 81.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.20 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze imidazole-1-carboxamide;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazole-1-carboxamide;propan-2-ol?
The IUPAC name of imidazole-1-carboxamide;propan-2-ol (CID 121360857) is imidazole-1-carboxamide;propan-2-ol.
What is the SMILES notation for imidazole-1-carboxamide;propan-2-ol?
The canonical SMILES for imidazole-1-carboxamide;propan-2-ol is CC(C)O.NC(=O)n1ccnc1.
What is the InChIKey of imidazole-1-carboxamide;propan-2-ol?
The InChIKey is QLDXFVPFINWQNR-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5N3O.C3H8O/c5-4(8)7-2-1-6-3-7;1-3(2)4/h1-3H,(H2,5,8);3-4H,1-2H3.
What are the key properties of imidazole-1-carboxamide;propan-2-ol?
imidazole-1-carboxamide;propan-2-ol has a molecular weight of 171.20 g/mol, XLogP of 0.20, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for imidazole-1-carboxamide;propan-2-ol is sourced from PubChem (CID 121360857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).