About di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate
di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate (PubChem CID 129285445) has the molecular formula C12H15ClN4O3
and a molecular weight of 298.73 g/mol. Its IUPAC name is di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate.
Molecular Properties
| Compound Name | di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate |
| PubChem CID | 129285445 |
| Molecular Formula | C12H15ClN4O3 |
| Molecular Weight | 298.73 g/mol |
| Exact Mass | 298.08 |
| IUPAC Name | di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate |
| SMILES | CC(C)COC(=O)Cl.O=C(n1ccnc1)n1ccnc1 |
| InChI | InChI=1S/C7H6N4O.C5H9ClO2/c12-7(10-3-1-8-5-10)11-4-2-9-6-11;1-4(2)3-8-5(6)7/h1-6H;4H,3H2,1-2H3 |
| InChIKey | VYRRUAYZFQKMIJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 79.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.73 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate?
The IUPAC name of di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate (CID 129285445) is di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate.
What is the SMILES notation for di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate?
The canonical SMILES for di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate is CC(C)COC(=O)Cl.O=C(n1ccnc1)n1ccnc1.
What is the InChIKey of di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate?
The InChIKey is VYRRUAYZFQKMIJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6N4O.C5H9ClO2/c12-7(10-3-1-8-5-10)11-4-2-9-6-11;1-4(2)3-8-5(6)7/h1-6H;4H,3H2,1-2H3.
What are the key properties of di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate?
di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate has a molecular weight of 298.73 g/mol, XLogP of 2.61, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for di(imidazol-1-yl)methanone;2-methylpropyl carbonochloridate is sourced from PubChem (CID 129285445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).