About 3-methylbutyl imidazole-1-carboximidate
3-methylbutyl imidazole-1-carboximidate (PubChem CID 12031764) has the molecular formula C9H15N3O
and a molecular weight of 181.24 g/mol. Its IUPAC name is 3-methylbutyl imidazole-1-carboximidate.
Molecular Properties
| Compound Name | 3-methylbutyl imidazole-1-carboximidate |
| PubChem CID | 12031764 |
| Molecular Formula | C9H15N3O |
| Molecular Weight | 181.24 g/mol |
| Exact Mass | 181.12 |
| IUPAC Name | 3-methylbutyl imidazole-1-carboximidate |
| SMILES | [H]/N=C(\OCCC(C)C)n1ccnc1 |
| InChI | InChI=1S/C9H15N3O/c1-8(2)3-6-13-9(10)12-5-4-11-7-12/h4-5,7-8,10H,3,6H2,1-2H3/b10-9- |
| InChIKey | APPWTSWRJHMYDQ-KTKRTIGZSA-N |
| XLogP | 1.73 |
| TPSA | 50.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.24 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 3-methylbutyl imidazole-1-carboximidate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylbutyl imidazole-1-carboximidate?
The IUPAC name of 3-methylbutyl imidazole-1-carboximidate (CID 12031764) is 3-methylbutyl imidazole-1-carboximidate.
What is the SMILES notation for 3-methylbutyl imidazole-1-carboximidate?
The canonical SMILES for 3-methylbutyl imidazole-1-carboximidate is [H]/N=C(\OCCC(C)C)n1ccnc1.
What is the InChIKey of 3-methylbutyl imidazole-1-carboximidate?
The InChIKey is APPWTSWRJHMYDQ-KTKRTIGZSA-N. The full InChI is InChI=1S/C9H15N3O/c1-8(2)3-6-13-9(10)12-5-4-11-7-12/h4-5,7-8,10H,3,6H2,1-2H3/b10-9-.
What are the key properties of 3-methylbutyl imidazole-1-carboximidate?
3-methylbutyl imidazole-1-carboximidate has a molecular weight of 181.24 g/mol, XLogP of 1.73, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylbutyl imidazole-1-carboximidate is sourced from PubChem (CID 12031764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).