About methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole
methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole (PubChem CID 174740575) has the molecular formula C8H12N2O3
and a molecular weight of 184.19 g/mol. Its IUPAC name is methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole.
Molecular Properties
| Compound Name | methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole |
| PubChem CID | 174740575 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole |
| SMILES | C=C(C)n1ccnc1.COC(=O)O |
| InChI | InChI=1S/C6H8N2.C2H4O3/c1-6(2)8-4-3-7-5-8;1-5-2(3)4/h3-5H,1H2,2H3;1H3,(H,3,4) |
| InChIKey | YHHTUFKGRUGBJE-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole?
The IUPAC name of methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole (CID 174740575) is methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole.
What is the SMILES notation for methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole?
The canonical SMILES for methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole is C=C(C)n1ccnc1.COC(=O)O.
What is the InChIKey of methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole?
The InChIKey is YHHTUFKGRUGBJE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H8N2.C2H4O3/c1-6(2)8-4-3-7-5-8;1-5-2(3)4/h3-5H,1H2,2H3;1H3,(H,3,4).
What are the key properties of methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole?
methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole has a molecular weight of 184.19 g/mol, XLogP of 1.68, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl hydrogen carbonate;1-prop-1-en-2-ylimidazole is sourced from PubChem (CID 174740575), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).