C10H13N3O3 — CID 67424696
2-(imidazole-1-carbonylamino)ethyl 2-methylprop-2-enoate (PubChem CID 67424696) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 2-(imidazole-1-carbonylamino)ethyl 2-methylprop-2-enoate.
| Compound Name | 2-(imidazole-1-carbonylamino)ethyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 67424696 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 2-(imidazole-1-carbonylamino)ethyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCNC(=O)n1ccnc1 |
| InChI | InChI=1S/C10H13N3O3/c1-8(2)9(14)16-6-4-12-10(15)13-5-3-11-7-13/h3,5,7H,1,4,6H2,2H3,(H,12,15) |
| InChIKey | KRFWTVIQLLYECF-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|