C18H30N4O5 — CID 10571966
tert-butyl (2S)-5-(imidazole-1-carbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate (PubChem CID 10571966) has the molecular formula C18H30N4O5 and a molecular weight of 382.46 g/mol. Its IUPAC name is tert-butyl (2S)-5-(imidazole-1-carbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate.
| Compound Name | tert-butyl (2S)-5-(imidazole-1-carbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
|---|---|
| PubChem CID | 10571966 |
| Molecular Formula | C18H30N4O5 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.22 |
| IUPAC Name | tert-butyl (2S)-5-(imidazole-1-carbonylamino)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CCCNC(=O)n1ccnc1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30N4O5/c1-17(2,3)26-14(23)13(21-16(25)27-18(4,5)6)8-7-9-20-15(24)22-11-10-19-12-22/h10-13H,7-9H2,1-6H3,(H,20,24)(H,21,25)/t13-/m0/s1 |
| InChIKey | VWCWPIHWAWBGMO-ZDUSSCGKSA-N |
| XLogP | 2.46 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|