C13H21N3O3 — CID 170928614
tert-butyl N-[(2S)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate (PubChem CID 170928614) has the molecular formula C13H21N3O3 and a molecular weight of 267.33 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 170928614 |
| Molecular Formula | C13H21N3O3 |
| Molecular Weight | 267.33 g/mol |
| Exact Mass | 267.16 |
| IUPAC Name | tert-butyl N-[(2S)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate |
| SMILES | CCC[C@H](NC(=O)OC(C)(C)C)C(=O)n1ccnc1 |
| InChI | InChI=1S/C13H21N3O3/c1-5-6-10(11(17)16-8-7-14-9-16)15-12(18)19-13(2,3)4/h7-10H,5-6H2,1-4H3,(H,15,18)/t10-/m0/s1 |
| InChIKey | NYJQEKSSQZBWGB-JTQLQIEISA-N |
| XLogP | 2.22 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.33 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |