C14H21N3O4 — CID 162057362
tert-butyl N-[(3S)-6-imidazol-1-yl-2,6-dioxohexan-3-yl]carbamate (PubChem CID 162057362) has the molecular formula C14H21N3O4 and a molecular weight of 295.34 g/mol. Its IUPAC name is tert-butyl N-[(3S)-6-imidazol-1-yl-2,6-dioxohexan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-6-imidazol-1-yl-2,6-dioxohexan-3-yl]carbamate |
|---|---|
| PubChem CID | 162057362 |
| Molecular Formula | C14H21N3O4 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.15 |
| IUPAC Name | tert-butyl N-[(3S)-6-imidazol-1-yl-2,6-dioxohexan-3-yl]carbamate |
| SMILES | CC(=O)[C@H](CCC(=O)n1ccnc1)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H21N3O4/c1-10(18)11(16-13(20)21-14(2,3)4)5-6-12(19)17-8-7-15-9-17/h7-9,11H,5-6H2,1-4H3,(H,16,20)/t11-/m0/s1 |
| InChIKey | CYHFWFZLRWWLRD-NSHDSACASA-N |
| XLogP | 1.79 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |