C14H23N5O4 — CID 175186155
tert-butyl N-[5-(carbamoylamino)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate (PubChem CID 175186155) has the molecular formula C14H23N5O4 and a molecular weight of 325.37 g/mol. Its IUPAC name is tert-butyl N-[5-(carbamoylamino)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-(carbamoylamino)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 175186155 |
| Molecular Formula | C14H23N5O4 |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.18 |
| IUPAC Name | tert-butyl N-[5-(carbamoylamino)-1-imidazol-1-yl-1-oxopentan-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CCCNC(N)=O)C(=O)n1ccnc1 |
| InChI | InChI=1S/C14H23N5O4/c1-14(2,3)23-13(22)18-10(5-4-6-17-12(15)21)11(20)19-8-7-16-9-19/h7-10H,4-6H2,1-3H3,(H,18,22)(H3,15,17,21) |
| InChIKey | KQDVWPZLSSZJCH-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 128.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|