C21H41N3O6 — CID 86625123
tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pentanoate (PubChem CID 86625123) has the molecular formula C21H41N3O6 and a molecular weight of 431.57 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pentanoate.
| Compound Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pentanoate |
|---|---|
| PubChem CID | 86625123 |
| Molecular Formula | C21H41N3O6 |
| Molecular Weight | 431.57 g/mol |
| Exact Mass | 431.30 |
| IUPAC Name | tert-butyl (2S)-2-[(2-methylpropan-2-yl)oxycarbonylamino]-5-[2-[(2-methylpropan-2-yl)oxycarbonylamino]ethylamino]pentanoate |
| SMILES | CC(C)(C)OC(=O)NCCNCCC[C@H](NC(=O)OC(C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C21H41N3O6/c1-19(2,3)28-16(25)15(24-18(27)30-21(7,8)9)11-10-12-22-13-14-23-17(26)29-20(4,5)6/h15,22H,10-14H2,1-9H3,(H,23,26)(H,24,27)/t15-/m0/s1 |
| InChIKey | IYBVMAOGHRCFOW-HNNXBMFYSA-N |
| XLogP | 3.12 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.57 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|