C19H28F2N4O6 — CID 163764533
tert-butyl N-[(2S)-5-(carbamoylamino)-1-[2,6-difluoro-4-[hydroxy(methoxy)methyl]anilino]-1-oxopentan-2-yl]carbamate (PubChem CID 163764533) has the molecular formula C19H28F2N4O6 and a molecular weight of 446.45 g/mol. Its IUPAC name is tert-butyl N-[(2S)-5-(carbamoylamino)-1-[2,6-difluoro-4-[hydroxy(methoxy)methyl]anilino]-1-oxopentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-5-(carbamoylamino)-1-[2,6-difluoro-4-[hydroxy(methoxy)methyl]anilino]-1-oxopentan-2-yl]carbamate |
|---|---|
| PubChem CID | 163764533 |
| Molecular Formula | C19H28F2N4O6 |
| Molecular Weight | 446.45 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | tert-butyl N-[(2S)-5-(carbamoylamino)-1-[2,6-difluoro-4-[hydroxy(methoxy)methyl]anilino]-1-oxopentan-2-yl]carbamate |
| SMILES | COC(O)c1cc(F)c(NC(=O)[C@H](CCCNC(N)=O)NC(=O)OC(C)(C)C)c(F)c1 |
| InChI | InChI=1S/C19H28F2N4O6/c1-19(2,3)31-18(29)24-13(6-5-7-23-17(22)28)15(26)25-14-11(20)8-10(9-12(14)21)16(27)30-4/h8-9,13,16,27H,5-7H2,1-4H3,(H,24,29)(H,25,26)(H3,22,23,28)/t13-,16?/m0/s1 |
| InChIKey | MBCJMWYQKOSRMF-KNVGNIICSA-N |
| XLogP | 1.88 |
| TPSA | 152.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.45 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|