C28H41ClN6O7 — CID 155320338
tert-butyl N-[1-[[5-(carbamoylamino)-1-[4-(chloromethyl)-3-(prop-2-ynylcarbamoyloxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate (PubChem CID 155320338) has the molecular formula C28H41ClN6O7 and a molecular weight of 609.12 g/mol. Its IUPAC name is tert-butyl N-[1-[[5-(carbamoylamino)-1-[4-(chloromethyl)-3-(prop-2-ynylcarbamoyloxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[[5-(carbamoylamino)-1-[4-(chloromethyl)-3-(prop-2-ynylcarbamoyloxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 155320338 |
| Molecular Formula | C28H41ClN6O7 |
| Molecular Weight | 609.12 g/mol |
| Exact Mass | 608.27 |
| IUPAC Name | tert-butyl N-[1-[[5-(carbamoylamino)-1-[4-(chloromethyl)-3-(prop-2-ynylcarbamoyloxymethyl)anilino]-1-oxopentan-2-yl]amino]-3-methyl-1-oxobutan-2-yl]carbamate |
| SMILES | C#CCNC(=O)OCc1cc(NC(=O)C(CCCNC(N)=O)NC(=O)C(NC(=O)OC(C)(C)C)C(C)C)ccc1CCl |
| InChI | InChI=1S/C28H41ClN6O7/c1-7-12-32-26(39)41-16-19-14-20(11-10-18(19)15-29)33-23(36)21(9-8-13-31-25(30)38)34-24(37)22(17(2)3)35-27(40)42-28(4,5)6/h1,10-11,14,17,21-22H,8-9,12-13,15-16H2,2-6H3,(H,32,39)(H,33,36)(H,34,37)(H,35,40)(H3,30,31,38) |
| InChIKey | RQUDUGFVJUFBBR-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 189.98 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.12 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|